Products 2490401-57-3

CAS 2490401-57-3 is the registry number for FP802 (dihydrochloride), 99.84%. Offered by: MedChemExpress. Available pack sizes: 25 mg, 10 mg, 5 mg, 100 mg, 50 mg.

Structural formula: {0} (CAS {1})

N'-[(3-chlorophenyl)methyl]-N'-ethylethane-1,2-diamine;dihydrochloride (CAS 2490401-57-3) is a chemical compound with the molecular formula C11H19Cl3N2 and a molecular weight of 285.6 g/mol. IUPAC name: N'-[(3-chlorophenyl)methyl]-N'-ethylethane-1,2-diamine;dihydrochloride. InChIKey: KNYWQXSEHYWECS-UHFFFAOYSA-N.

Identity
Molecular formulaC11H19Cl3N2
Molecular weight285.6 g/mol
IUPAC nameN'-[(3-chlorophenyl)methyl]-N'-ethylethane-1,2-diamine;dihydrochloride
InChIKeyKNYWQXSEHYWECS-UHFFFAOYSA-N
SMILESCCN(CCN)CC1=CC(=CC=C1)Cl.Cl.Cl

Computed by PubChem (NCBI)