CAS 1803585-41-2 appears in our catalog under these names: (3-Amino-2-(4-chlorophenyl)propyl)dimethylamine dihydrochloride, (3-Amino-2-(4-chlorophenyl)propyl)dimethylamine dihydrochloride, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 0,5g, 50mg, 1g.
2-(4-chlorophenyl)-N',N'-dimethylpropane-1,3-diamine;dihydrochloride (CAS 1803585-41-2) is a chemical compound with the molecular formula C11H19Cl3N2 and a molecular weight of 285.6 g/mol. IUPAC name: 2-(4-chlorophenyl)-N',N'-dimethylpropane-1,3-diamine;dihydrochloride. InChIKey: HJAMBSURPRFUBN-UHFFFAOYSA-N.
| Molecular formula | C11H19Cl3N2 |
|---|---|
| Molecular weight | 285.6 g/mol |
| IUPAC name | 2-(4-chlorophenyl)-N',N'-dimethylpropane-1,3-diamine;dihydrochloride |
| InChIKey | HJAMBSURPRFUBN-UHFFFAOYSA-N |
| SMILES | CN(C)CC(CN)C1=CC=C(C=C1)Cl.Cl.Cl |
Computed by PubChem (NCBI)