cas: 14353-88-9 — see every product listed under this CAS number, including other names
FPIFA 97% (CAS 14353-88-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A422899-100mg |
| cas | 14353-88-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 170.12 Pln | |
| Ambeed | 250mg | 214.62 Pln | |
| Ambeed | 1g | 487.19 Pln | |
| Ambeed | 5g | 1666.44 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A422899 |
[(2,3,4,5,6-pentafluorophenyl)-(2,2,2-trifluoroacetyl)oxy-lambda3-iodanyl] 2,2,2-trifluoroacetate (CAS 14353-88-9) is a chemical compound with the molecular formula C10F11IO4 and a molecular weight of 519.99 g/mol. IUPAC name: [(2,3,4,5,6-pentafluorophenyl)-(2,2,2-trifluoroacetyl)oxy-lambda3-iodanyl] 2,2,2-trifluoroacetate. InChIKey: OQWAXRPJEPTTSZ-UHFFFAOYSA-N.
| Molecular formula | C10F11IO4 |
|---|---|
| Molecular weight | 519.99 g/mol |
| IUPAC name | [(2,3,4,5,6-pentafluorophenyl)-(2,2,2-trifluoroacetyl)oxy-lambda3-iodanyl] 2,2,2-trifluoroacetate |
| InChIKey | OQWAXRPJEPTTSZ-UHFFFAOYSA-N |
| SMILES | C1(=C(C(=C(C(=C1F)F)I(OC(=O)C(F)(F)F)OC(=O)C(F)(F)F)F)F)F |
Computed by PubChem (NCBI)