CAS 174185-16-1 appears in our catalog under these names: FR–167356, FR-167356/ 99.19% (existing batch purity), FR-167356. Offered by: GLPBio, TargetMol, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 1 mg.
2,6-dichloro-N-[3-(2-hydroxypropan-2-yl)-2-methyl-1-benzofuran-7-yl]benzamide (CAS 174185-16-1) is a chemical compound with the molecular formula C19H17Cl2NO3 and a molecular weight of 378.2 g/mol. IUPAC name: 2,6-dichloro-N-[3-(2-hydroxypropan-2-yl)-2-methyl-1-benzofuran-7-yl]benzamide. InChIKey: GCAOVMKRBUCSET-UHFFFAOYSA-N.
| Molecular formula | C19H17Cl2NO3 |
|---|---|
| Molecular weight | 378.2 g/mol |
| IUPAC name | 2,6-dichloro-N-[3-(2-hydroxypropan-2-yl)-2-methyl-1-benzofuran-7-yl]benzamide |
| InChIKey | GCAOVMKRBUCSET-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(O1)C(=CC=C2)NC(=O)C3=C(C=CC=C3Cl)Cl)C(C)(C)O |
Computed by PubChem (NCBI)