CAS 156547-56-7 appears in our catalog under these names: FSCPX, 98%, FSCPX, FSCPX/ 98%, FSCPX 98%, FSCPX, 99.72%. Offered by: AmBeed, GLPBio, TargetMol, Chemat, MedChemExpress. Available pack sizes: 100mg, 1mg, 5mg, 10mg, 25mg, 50mg, 10mM (in 1ml dmso), 200mg.
3-(8-cyclopentyl-2,6-dioxo-1-propyl-7H-purin-3-yl)propyl 4-fluorosulfonylbenzoate (CAS 156547-56-7) is a chemical compound with the molecular formula C23H27FN4O6S and a molecular weight of 506.5 g/mol. IUPAC name: 3-(8-cyclopentyl-2,6-dioxo-1-propyl-7H-purin-3-yl)propyl 4-fluorosulfonylbenzoate. InChIKey: XJLGXHIRSHTRPQ-UHFFFAOYSA-N.
| Molecular formula | C23H27FN4O6S |
|---|---|
| Molecular weight | 506.5 g/mol |
| IUPAC name | 3-(8-cyclopentyl-2,6-dioxo-1-propyl-7H-purin-3-yl)propyl 4-fluorosulfonylbenzoate |
| InChIKey | XJLGXHIRSHTRPQ-UHFFFAOYSA-N |
| SMILES | CCCN1C(=O)C2=C(N=C(N2)C3CCCC3)N(C1=O)CCCOC(=O)C4=CC=C(C=C4)S(=O)(=O)F |
Computed by PubChem (NCBI)