CAS 1630808-89-7 appears in our catalog under these names: FT113/ 97.68% (existing batch purity), FT113, FT113, 97%, 97%, FT113, 99.39%, (4-(4-(6-FLUOROBENZO[D]OXAZOL-2-YL)BENZOYL)PIPERAZIN-1-YL)(1-HYDROXYCYCLOPROPYL)METHANONE, 100%. Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso), 50 mg.
[4-(6-fluoro-1,3-benzoxazol-2-yl)phenyl]-[4-(1-hydroxycyclopropanecarbonyl)piperazin-1-yl]methanone (CAS 1630808-89-7) is a chemical compound with the molecular formula C22H20FN3O4 and a molecular weight of 409.4 g/mol. IUPAC name: [4-(6-fluoro-1,3-benzoxazol-2-yl)phenyl]-[4-(1-hydroxycyclopropanecarbonyl)piperazin-1-yl]methanone. InChIKey: DSTWHRGOCUOKDE-UHFFFAOYSA-N.
| Molecular formula | C22H20FN3O4 |
|---|---|
| Molecular weight | 409.4 g/mol |
| IUPAC name | [4-(6-fluoro-1,3-benzoxazol-2-yl)phenyl]-[4-(1-hydroxycyclopropanecarbonyl)piperazin-1-yl]methanone |
| InChIKey | DSTWHRGOCUOKDE-UHFFFAOYSA-N |
| SMILES | C1CC1(C(=O)N2CCN(CC2)C(=O)C3=CC=C(C=C3)C4=NC5=C(O4)C=C(C=C5)F)O |
Computed by PubChem (NCBI)