CAS 1035688-66-4 appears in our catalog under these names: Farudodstat/ 98.03% (existing batch purity), ASLAN003, Farudodstat 97%, 2-((3,5-Difluoro-3'-methoxy-[1,1'-biphenyl]-4-yl)amino)nicotinic acid, 97%, 97%, Farudodstat, 99.95%. Offered by: TargetMol, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso), 1mg, 250mg.
2-[2,6-difluoro-4-(3-methoxyphenyl)anilino]pyridine-3-carboxylic acid (CAS 1035688-66-4) is a chemical compound with the molecular formula C19H14F2N2O3 and a molecular weight of 356.3 g/mol. IUPAC name: 2-[2,6-difluoro-4-(3-methoxyphenyl)anilino]pyridine-3-carboxylic acid. InChIKey: OMPATGZMNFWVOH-UHFFFAOYSA-N.
| Molecular formula | C19H14F2N2O3 |
|---|---|
| Molecular weight | 356.3 g/mol |
| IUPAC name | 2-[2,6-difluoro-4-(3-methoxyphenyl)anilino]pyridine-3-carboxylic acid |
| InChIKey | OMPATGZMNFWVOH-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC(=C1)C2=CC(=C(C(=C2)F)NC3=C(C=CC=N3)C(=O)O)F |
Computed by PubChem (NCBI)