CAS 863193-70-8 appears in our catalog under these names: Fenlean/ 98.99% (existing batch purity), Fenlean, Fenlean, 99.56%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 2mg, 200mg.
(E)-2-(2,5-dimethoxyphenyl)-3-(4-hydroxy-3-methoxyphenyl)-N-[2-(4-hydroxyphenyl)ethyl]prop-2-enamide (CAS 863193-70-8) is a chemical compound with the molecular formula C26H27NO6 and a molecular weight of 449.5 g/mol. IUPAC name: (E)-2-(2,5-dimethoxyphenyl)-3-(4-hydroxy-3-methoxyphenyl)-N-[2-(4-hydroxyphenyl)ethyl]prop-2-enamide. InChIKey: ZZTHOXZXWINLQI-HYARGMPZSA-N.
| Molecular formula | C26H27NO6 |
|---|---|
| Molecular weight | 449.5 g/mol |
| IUPAC name | (E)-2-(2,5-dimethoxyphenyl)-3-(4-hydroxy-3-methoxyphenyl)-N-[2-(4-hydroxyphenyl)ethyl]prop-2-enamide |
| InChIKey | ZZTHOXZXWINLQI-HYARGMPZSA-N |
| SMILES | COC1=CC(=C(C=C1)OC)/C(=C\C2=CC(=C(C=C2)O)OC)/C(=O)NCCC3=CC=C(C=C3)O |
Computed by PubChem (NCBI)