Ferrocenecarboxaldehyde, 97%
cas: 12093-10-6 — see every product listed under this CAS number, including other names
Ferrocenecarboxaldehyde, 97% (CAS 12093-10-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A390081-1g |
| cas | 12093-10-6 |
| size | 1g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 142.31 Pln | |
| Ambeed | 5g | 175.69 Pln | |
| Ambeed | 10g | 220.19 Pln | |
| Ambeed | 25g | 414.88 Pln | |
| Ambeed | 100g | 960.00 Pln | |
| Ambeed | 500g | 4508.88 Pln | |
| BLDpharm | 1g | 186.63 Pln | |
| BLDpharm | 5g | 208.84 Pln | |
| BLDpharm | 25g | 442.09 Pln | |
| BLDpharm | 100g | 1030.77 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
Cyclopenta-1,3-diene;cyclopenta-1,3-diene-1-carbaldehyde;iron(2+) (CAS 12093-10-6) is a chemical compound with the molecular formula C11H10FeO and a molecular weight of 214.04 g/mol. IUPAC name: cyclopenta-1,3-diene;cyclopenta-1,3-diene-1-carbaldehyde;iron(2+). InChIKey: MQHZGUNMWQBVDK-UHFFFAOYSA-N.
| Molecular formula | C11H10FeO |
|---|---|
| Molecular weight | 214.04 g/mol |
| IUPAC name | cyclopenta-1,3-diene;cyclopenta-1,3-diene-1-carbaldehyde;iron(2+) |
| InChIKey | MQHZGUNMWQBVDK-UHFFFAOYSA-N |
| SMILES | [CH-]1C=CC=C1.[CH-]1C=CC=C1C=O.[Fe+2] |
Computed by PubChem (NCBI)