CAS 12093-10-6 appears in our catalog under these names: Ferrocenecarboxaldehyde, Ferrocenecarboxaldehyde, 97% , Ferrocenecarboxaldehyde, 98%, Ferrocenecarboxaldehyde, >97.0%(GC)(T), Ferrocenecarboxaldehyde 97%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), Thermo Scientific (Acros), TCI, Ambeed. Available pack sizes: 100g, 25g, 5g, 2g, 10g, 1g, 500g, 1kg.
Cyclopenta-1,3-diene;cyclopenta-1,3-diene-1-carbaldehyde;iron(2+) (CAS 12093-10-6) is a chemical compound with the molecular formula C11H10FeO and a molecular weight of 214.04 g/mol. IUPAC name: cyclopenta-1,3-diene;cyclopenta-1,3-diene-1-carbaldehyde;iron(2+). InChIKey: MQHZGUNMWQBVDK-UHFFFAOYSA-N.
| Molecular formula | C11H10FeO |
|---|---|
| Molecular weight | 214.04 g/mol |
| IUPAC name | cyclopenta-1,3-diene;cyclopenta-1,3-diene-1-carbaldehyde;iron(2+) |
| InChIKey | MQHZGUNMWQBVDK-UHFFFAOYSA-N |
| SMILES | [CH-]1C=CC=C1.[CH-]1C=CC=C1C=O.[Fe+2] |
Computed by PubChem (NCBI)