CAS 20150-34-9 appears in our catalog under these names: Ferrous Bisglycinate, Ferrous Bisglycinate/ 98%, Ferrous bisglycinate, Ferrous glycinate, Ferrous Bisglycinate, 98%, 98%. Offered by: Chemat Brand, TRC, TargetMol, GLPBio, Biosynth. Available pack sizes: on request, 10g, 1g, 500mg, 10mM (in 1ml dmso), 250mg, 2kg, 1kg.
Bis(2-aminoacetate);iron(2+) (CAS 20150-34-9) is a chemical compound with the molecular formula C4H8FeN2O4 and a molecular weight of 203.96 g/mol. IUPAC name: bis(2-aminoacetate);iron(2+). InChIKey: GIPOFCXYHMWROH-UHFFFAOYSA-L.
| Molecular formula | C4H8FeN2O4 |
|---|---|
| Molecular weight | 203.96 g/mol |
| IUPAC name | bis(2-aminoacetate);iron(2+) |
| InChIKey | GIPOFCXYHMWROH-UHFFFAOYSA-L |
| SMILES | C(C(=O)[O-])N.C(C(=O)[O-])N.[Fe+2] |
Computed by PubChem (NCBI)