CAS 150586-58-6 appears in our catalog under these names: Fipamezole/ 99.32% (existing batch purity), Fipamezole. Offered by: TargetMol, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 25mg, 50mg, 100mg, 10mg, 5 mg, 1 mg.
5-(2-ethyl-5-fluoro-1,3-dihydroinden-2-yl)-1H-imidazole (CAS 150586-58-6) is a chemical compound with the molecular formula C14H15FN2 and a molecular weight of 230.28 g/mol. IUPAC name: 5-(2-ethyl-5-fluoro-1,3-dihydroinden-2-yl)-1H-imidazole. InChIKey: KXSUAWAUCNFBQJ-UHFFFAOYSA-N.
| Molecular formula | C14H15FN2 |
|---|---|
| Molecular weight | 230.28 g/mol |
| IUPAC name | 5-(2-ethyl-5-fluoro-1,3-dihydroinden-2-yl)-1H-imidazole |
| InChIKey | KXSUAWAUCNFBQJ-UHFFFAOYSA-N |
| SMILES | CCC1(CC2=C(C1)C=C(C=C2)F)C3=CN=CN3 |
Computed by PubChem (NCBI)