CAS 596-09-8 appears in our catalog under these names: Fluorescein diacetate, 98%, Diacetylfluorescein, >95% (HPLC), Diacetylfluorescein, Fluorescein diacetate/ 97.3% (existing batch purity), Fluorescein diacetate, 97%, pure. Offered by: Combi-blocks, TRC, AmBeed, Mikromol, LoGiCal. Available pack sizes: 25g, 5g, 1g, 250mg, 100mg, 10mg, 500mg, 100g.
(6'-acetyloxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl) acetate (CAS 596-09-8) is a chemical compound with the molecular formula C24H16O7 and a molecular weight of 416.4 g/mol. IUPAC name: (6'-acetyloxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl) acetate. InChIKey: CHADEQDQBURGHL-UHFFFAOYSA-N.
| Molecular formula | C24H16O7 |
|---|---|
| Molecular weight | 416.4 g/mol |
| IUPAC name | (6'-acetyloxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl) acetate |
| InChIKey | CHADEQDQBURGHL-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=CC2=C(C=C1)C3(C4=C(O2)C=C(C=C4)OC(=O)C)C5=CC=CC=C5C(=O)O3 |
Computed by PubChem (NCBI)