Fmoc-β-Ala-Glu(OtBu)-OH, 95%
cas: 2411592-43-1 — see every product listed under this CAS number, including other names
Fmoc-β-Ala-Glu(OtBu)-OH, 95% (CAS 2411592-43-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 100mg. Offered by: Ambeed, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A1378257-250mg |
| cas | 2411592-43-1 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 1010.06 Pln | |
| Ambeed | 1g | 1961.25 Pln | |
| Ambeed | 5g | 5738.19 Pln | |
| Ambeed | 10g | 9142.44 Pln | |
| Fluorochem | 100mg | 633.13 Pln | |
| Fluorochem | 250mg | 997.58 Pln | |
| Fluorochem | 1g | 1997.23 Pln | |
| Fluorochem | 5g | 5787.56 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
(2S)-2-[3-(9H-fluoren-9-ylmethoxycarbonylamino)propanoylamino]-5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoic acid (CAS 2411592-43-1) is a chemical compound with the molecular formula C27H32N2O7 and a molecular weight of 496.6 g/mol. IUPAC name: (2S)-2-[3-(9H-fluoren-9-ylmethoxycarbonylamino)propanoylamino]-5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoic acid. InChIKey: QHQCFGNAEGYJGJ-QFIPXVFZSA-N.
| Molecular formula | C27H32N2O7 |
|---|---|
| Molecular weight | 496.6 g/mol |
| IUPAC name | (2S)-2-[3-(9H-fluoren-9-ylmethoxycarbonylamino)propanoylamino]-5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoic acid |
| InChIKey | QHQCFGNAEGYJGJ-QFIPXVFZSA-N |
| SMILES | CC(C)(C)OC(=O)CC[C@@H](C(=O)O)NC(=O)CCNC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)