Products 79125-22-7
CAS 79125-22-7 is the registry number for Bopindolol (fumarate). Offered by: MedChemExpress. Available pack sizes: Get quote.
(E)-but-2-enedioic acid;[1-(tert-butylamino)-3-[(2-methyl-1H-indol-4-yl)oxy]propan-2-yl] benzoate (CAS 79125-22-7) is a chemical compound with the molecular formula C27H32N2O7 and a molecular weight of 496.6 g/mol. IUPAC name: (E)-but-2-enedioic acid;[1-(tert-butylamino)-3-[(2-methyl-1H-indol-4-yl)oxy]propan-2-yl] benzoate. InChIKey: SRGXLPJWUNBTKJ-WLHGVMLRSA-N.
| Molecular formula | C27H32N2O7 |
|---|---|
| Molecular weight | 496.6 g/mol |
| IUPAC name | (E)-but-2-enedioic acid;[1-(tert-butylamino)-3-[(2-methyl-1H-indol-4-yl)oxy]propan-2-yl] benzoate |
| InChIKey | SRGXLPJWUNBTKJ-WLHGVMLRSA-N |
| SMILES | CC1=CC2=C(N1)C=CC=C2OCC(CNC(C)(C)C)OC(=O)C3=CC=CC=C3.C(=C/C(=O)O)\C(=O)O |
Computed by PubChem (NCBI)