cas: 868599-75-1 — see every product listed under this CAS number, including other names
Fmoc-1-amino-4,7,10-trioxa-13-tridecanamine hydrochloride, 97%, 97% (CAS 868599-75-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11GTU2-100mg |
| cas | 868599-75-1 |
| size | 100mg |
| availability | 30g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 146.00 Pln | |
| Chemat | 250mg | 256.40 Pln | |
| Chemat | 1g | 616.40 Pln | |
| Chemat | 5g | 2214.80 Pln | |
| Chemat | 10g | 4110.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
9H-fluoren-9-ylmethyl N-[3-[2-[2-(3-aminopropoxy)ethoxy]ethoxy]propyl]carbamate;hydrochloride (CAS 868599-75-1) is a chemical compound with the molecular formula C25H35ClN2O5 and a molecular weight of 479.0 g/mol. IUPAC name: 9H-fluoren-9-ylmethyl N-[3-[2-[2-(3-aminopropoxy)ethoxy]ethoxy]propyl]carbamate;hydrochloride. InChIKey: DDQYSNUVWDYITH-UHFFFAOYSA-N.
| Molecular formula | C25H35ClN2O5 |
|---|---|
| Molecular weight | 479.0 g/mol |
| IUPAC name | 9H-fluoren-9-ylmethyl N-[3-[2-[2-(3-aminopropoxy)ethoxy]ethoxy]propyl]carbamate;hydrochloride |
| InChIKey | DDQYSNUVWDYITH-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NCCCOCCOCCOCCCN.Cl |
Computed by PubChem (NCBI)