cas: 868599-75-1 — see every product listed under this CAS number, including other names
Fmoc-1-amino-4,7,10-trioxa-13-tridecanamine hydrochloride, 97% (CAS 868599-75-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F051252-250MG |
| cas | 868599-75-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 393.63 Pln | |
| Fluorochem | 1g | 997.58 Pln | |
| Fluorochem | 5g | 3637.28 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
9H-fluoren-9-ylmethyl N-[3-[2-[2-(3-aminopropoxy)ethoxy]ethoxy]propyl]carbamate;hydrochloride (CAS 868599-75-1) is a chemical compound with the molecular formula C25H35ClN2O5 and a molecular weight of 479.0 g/mol. IUPAC name: 9H-fluoren-9-ylmethyl N-[3-[2-[2-(3-aminopropoxy)ethoxy]ethoxy]propyl]carbamate;hydrochloride. InChIKey: DDQYSNUVWDYITH-UHFFFAOYSA-N.
| Molecular formula | C25H35ClN2O5 |
|---|---|
| Molecular weight | 479.0 g/mol |
| IUPAC name | 9H-fluoren-9-ylmethyl N-[3-[2-[2-(3-aminopropoxy)ethoxy]ethoxy]propyl]carbamate;hydrochloride |
| InChIKey | DDQYSNUVWDYITH-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NCCCOCCOCCOCCCN.Cl |
Computed by PubChem (NCBI)