cas: 285996-74-9 — see every product listed under this CAS number, including other names
Fmoc-1-amino-4-oxo-cyclohexane carboxylic acid, 95% (CAS 285996-74-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F493779-100MG |
| cas | 285996-74-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 487.35 Pln | |
| Fluorochem | 250mg | 810.15 Pln | |
| Fluorochem | 1g | 2559.53 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
1-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxocyclohexane-1-carboxylic acid (CAS 285996-74-9) is a chemical compound with the molecular formula C22H21NO5 and a molecular weight of 379.4 g/mol. IUPAC name: 1-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxocyclohexane-1-carboxylic acid. InChIKey: SHBYYFRMCILKOK-UHFFFAOYSA-N.
| Molecular formula | C22H21NO5 |
|---|---|
| Molecular weight | 379.4 g/mol |
| IUPAC name | 1-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxocyclohexane-1-carboxylic acid |
| InChIKey | SHBYYFRMCILKOK-UHFFFAOYSA-N |
| SMILES | C1CC(CCC1=O)(C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)