Fmoc-2,6-dimethyl-L-tyrosine, 98%, 98%
cas: 206060-54-0 — see every product listed under this CAS number, including other names
Fmoc-2,6-dimethyl-L-tyrosine, 98%, 98% (CAS 206060-54-0) is a chemical reagent available from Chemat. Available pack sizes: 50g, 100g, 250g, 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113AIN-50g |
| cas | 206060-54-0 |
| size | 50g |
| availability | 250g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 50g | 3242.00 Pln | |
| Chemat | 100g | 6328.40 Pln | |
| Chemat | 250g | 15558.80 Pln | |
| Chemat | 100mg | 98.00 Pln | |
| Chemat | 250mg | 146.00 Pln | |
| Chemat | 1g | 304.40 Pln | |
| Chemat | 5g | 1096.40 Pln | |
| Chemat | 10g | 1994.00 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(4-hydroxy-2,6-dimethylphenyl)propanoic acid (CAS 206060-54-0) is a chemical compound with the molecular formula C26H25NO5 and a molecular weight of 431.5 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(4-hydroxy-2,6-dimethylphenyl)propanoic acid. InChIKey: RHSSAHKTHNKPGU-DEOSSOPVSA-N.
| Molecular formula | C26H25NO5 |
|---|---|
| Molecular weight | 431.5 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(4-hydroxy-2,6-dimethylphenyl)propanoic acid |
| InChIKey | RHSSAHKTHNKPGU-DEOSSOPVSA-N |
| SMILES | CC1=CC(=CC(=C1C[C@@H](C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)C)O |
Computed by PubChem (NCBI)
Synonyms:
Fmoc-2,6-dimethyl-L-tyrosine, fmoc-l-(2,6-di-me)tyr-oh, L-Tyrosine, N-[(9H-fluoren-9-ylmethoxy)carbonyl]-2,6-dimethyl-, (S)-N-Fmoc-2,6-Dimethyltyrosine, N-Fmoc-2,6-dimethyl-L-tyrosine, Fmoc-L-2,6-Dimethyltyrosine, N-[(9H-fluoren-9-ylmethoxy)carbonyl]-2,6-dimethyl-L-Tyrosine, Fmoc-Tyr(2,6-DiMe)-OH, RHSSAHKTHNKPGU-DEOSSOPVSA-N, (S)-2-((((9H-Fluoren-9-yl)methoxy)