CAS 198542-01-7 appears in our catalog under these names: Fmoc-(3s,4s)-4-amino-3-hydroxy-5-phenyl pentanoic acid, 95%, Fmoc–(3s,4s)–4–amino–3–hydroxy–5–phenyl pentanoic acid, Fmoc-(3S,4S)-AHPPA-OH. Offered by: Combi-blocks, GLPBio, Iris Biotech. Available pack sizes: 100mg, 1g, 5g, 250mg, 10mg.
(3S,4S)-4-(9H-fluoren-9-ylmethoxycarbonylamino)-3-hydroxy-5-phenylpentanoic acid (CAS 198542-01-7) is a chemical compound with the molecular formula C26H25NO5 and a molecular weight of 431.5 g/mol. IUPAC name: (3S,4S)-4-(9H-fluoren-9-ylmethoxycarbonylamino)-3-hydroxy-5-phenylpentanoic acid. InChIKey: DDFWEZMWBJEUAX-ZEQRLZLVSA-N.
| Molecular formula | C26H25NO5 |
|---|---|
| Molecular weight | 431.5 g/mol |
| IUPAC name | (3S,4S)-4-(9H-fluoren-9-ylmethoxycarbonylamino)-3-hydroxy-5-phenylpentanoic acid |
| InChIKey | DDFWEZMWBJEUAX-ZEQRLZLVSA-N |
| SMILES | C1=CC=C(C=C1)C[C@@H]([C@H](CC(=O)O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)