cas: 138774-94-4 — see every product listed under this CAS number, including other names
Fmoc-3-(2-Naphthyl)-D-alanine, 96% (CAS 138774-94-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 50g, 100g, 250g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch1120IN-250mg |
| cas | 138774-94-4 |
| size | 250mg |
| availability | 548.5g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 146.00 Pln | |
| Chemat | 10g | 218.00 Pln | |
| Chemat | 25g | 438.80 Pln | |
| Chemat | 50g | 750.80 Pln | |
| Chemat | 100g | 1379.60 Pln | |
| Chemat | 250g | 2958.80 Pln | |
| Chemat | 500g | 5400.00 Pln | |
| Fluorochem | 250mg | 102.06 Pln | |
| Fluorochem | 1g | 107.27 Pln | |
| Fluorochem | 5g | 164.54 Pln | |
| Fluorochem | 10g | 232.23 Pln | |
| Fluorochem | 25g | 482.14 Pln | |
| Fluorochem | 100g | 1716.08 Pln | |
| Fluorochem | 500g | 6589.36 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-naphthalen-2-ylpropanoic acid (CAS 138774-94-4) is a chemical compound with the molecular formula C28H23NO4 and a molecular weight of 437.5 g/mol. IUPAC name: (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-naphthalen-2-ylpropanoic acid. InChIKey: JYUTZJVERLGMQZ-AREMUKBSSA-N.
| Molecular formula | C28H23NO4 |
|---|---|
| Molecular weight | 437.5 g/mol |
| IUPAC name | (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-naphthalen-2-ylpropanoic acid |
| InChIKey | JYUTZJVERLGMQZ-AREMUKBSSA-N |
| SMILES | C1=CC=C2C=C(C=CC2=C1)C[C@H](C(=O)O)NC(=O)OCC3C4=CC=CC=C4C5=CC=CC=C35 |
Computed by PubChem (NCBI)