CAS 1246659-36-8 appears in our catalog under these names: Fmoc-L-Ala(adamantyl)-OH, (2S)-3-(adamantan-1-yl)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)propanoic acid, ≥95%, ≥95%. Offered by: Iris Biotech, Chemat. Available pack sizes: 1g, 5g, 250mg.
(2S)-3-(1-adamantyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (CAS 1246659-36-8) is a chemical compound with the molecular formula C28H31NO4 and a molecular weight of 445.5 g/mol. IUPAC name: (2S)-3-(1-adamantyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid. InChIKey: KKIZUCSOMHYCNI-SNXCOZLRSA-N.
| Molecular formula | C28H31NO4 |
|---|---|
| Molecular weight | 445.5 g/mol |
| IUPAC name | (2S)-3-(1-adamantyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| InChIKey | KKIZUCSOMHYCNI-SNXCOZLRSA-N |
| SMILES | C1C2CC3CC1CC(C2)(C3)C[C@@H](C(=O)O)NC(=O)OCC4C5=CC=CC=C5C6=CC=CC=C46 |
Computed by PubChem (NCBI)