CAS 1883662-08-5 is the registry number for Fmoc-D-Ala(adamantyl)-OH. Offered by: Iris Biotech. Available pack sizes: 5g.
(2R)-3-(1-adamantyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (CAS 1883662-08-5) is a chemical compound with the molecular formula C28H31NO4 and a molecular weight of 445.5 g/mol. IUPAC name: (2R)-3-(1-adamantyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid. InChIKey: KKIZUCSOMHYCNI-GFZBZYAOSA-N.
| Molecular formula | C28H31NO4 |
|---|---|
| Molecular weight | 445.5 g/mol |
| IUPAC name | (2R)-3-(1-adamantyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| InChIKey | KKIZUCSOMHYCNI-GFZBZYAOSA-N |
| SMILES | C1C2CC3CC1CC(C2)(C3)C[C@H](C(=O)O)NC(=O)OCC4C5=CC=CC=C5C6=CC=CC=C46 |
Computed by PubChem (NCBI)