cas: 201481-37-0 — see every product listed under this CAS number, including other names
Fmoc-Allo-Thr(tBu)-OH 97% (CAS 201481-37-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A118672-100mg |
| cas | 201481-37-0 |
| size | 100mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 153.44 Pln | |
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 197.94 Pln | |
| Ambeed | 5g | 331.44 Pln | |
| Ambeed | 10g | 509.44 Pln | |
| Ambeed | 25g | 1165.81 Pln | |
| Ambeed | 100g | 4275.25 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A118672 |
(2S,3S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[(2-methylpropan-2-yl)oxy]butanoic acid (CAS 201481-37-0) is a chemical compound with the molecular formula C23H27NO5 and a molecular weight of 397.5 g/mol. IUPAC name: (2S,3S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[(2-methylpropan-2-yl)oxy]butanoic acid. InChIKey: LZOLWEQBVPVDPR-XOBRGWDASA-N.
| Molecular formula | C23H27NO5 |
|---|---|
| Molecular weight | 397.5 g/mol |
| IUPAC name | (2S,3S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[(2-methylpropan-2-yl)oxy]butanoic acid |
| InChIKey | LZOLWEQBVPVDPR-XOBRGWDASA-N |
| SMILES | C[C@@H]([C@@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13)OC(C)(C)C |
Computed by PubChem (NCBI)