cas: 146982-24-3 — see every product listed under this CAS number, including other names
Fmoc-Asp(OAll)-OH 97% (CAS 146982-24-3) is a chemical reagent available from Chemat. Available pack sizes: 1000g, 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A105894-1000g |
| cas | 146982-24-3 |
| size | 1000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1000g | 8864.31 Pln | |
| Ambeed | 1g | 120.06 Pln | |
| Ambeed | 5g | 175.69 Pln | |
| Ambeed | 10g | 197.94 Pln | |
| Ambeed | 25g | 348.12 Pln | |
| Ambeed | 100g | 1171.38 Pln | |
| Ambeed | 500g | 5565.75 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A105894 |
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxo-4-prop-2-enoxybutanoic acid (CAS 146982-24-3) is a chemical compound with the molecular formula C22H21NO6 and a molecular weight of 395.4 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxo-4-prop-2-enoxybutanoic acid. InChIKey: FBNFRRNBFASDKS-IBGZPJMESA-N.
| Molecular formula | C22H21NO6 |
|---|---|
| Molecular weight | 395.4 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxo-4-prop-2-enoxybutanoic acid |
| InChIKey | FBNFRRNBFASDKS-IBGZPJMESA-N |
| SMILES | C=CCOC(=O)C[C@@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)