cas: 146982-24-3 — see every product listed under this CAS number, including other names
Fmoc-Asp(OAll)-OH, 98%, 98% (CAS 146982-24-3) is a chemical reagent available from Chemat. Available pack sizes: 50g, 250g, 500g, 5kg, 10kg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114QMU-50g |
| cas | 146982-24-3 |
| size | 50g |
| availability | 25000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 50g | 597.20 Pln | |
| Chemat | 250g | 2541.20 Pln | |
| Chemat | 500g | 4819.20 Pln | |
| Chemat | 5kg | 30739.20 Pln | |
| Chemat | 10kg | price on request | |
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 122.00 Pln | |
| Chemat | 10g | 179.60 Pln | |
| Chemat | 25g | 338.00 Pln | |
| Chemat | 100g | 1096.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxo-4-prop-2-enoxybutanoic acid (CAS 146982-24-3) is a chemical compound with the molecular formula C22H21NO6 and a molecular weight of 395.4 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxo-4-prop-2-enoxybutanoic acid. InChIKey: FBNFRRNBFASDKS-IBGZPJMESA-N.
| Molecular formula | C22H21NO6 |
|---|---|
| Molecular weight | 395.4 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxo-4-prop-2-enoxybutanoic acid |
| InChIKey | FBNFRRNBFASDKS-IBGZPJMESA-N |
| SMILES | C=CCOC(=O)C[C@@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)