Fmoc-Asu(OtBu)-OH, 99.92%
cas: 276869-41-1 — see every product listed under this CAS number, including other names
Fmoc-Asu(OtBu)-OH, 99.92% (CAS 276869-41-1) is a chemical reagent available from Chemat. Available pack sizes: 1 g, 500 mg, 5 g, 250 mg, 100 mg. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W048733-1 g |
| cas | 276869-41-1 |
| size | 1 g |
| availability | In stock |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 1 g | 1415.68 Pln | |
| MedChemExpress | 500 mg | 937.34 Pln | |
| MedChemExpress | 5 g | 3356.87 Pln | |
| MedChemExpress | 250 mg | 630.84 Pln | |
| MedChemExpress | 100 mg | 375.42 Pln |
properties
| delivery time | 2-3 weeks |
|---|---|
| purity | 99.92% |
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-8-[(2-methylpropan-2-yl)oxy]-8-oxooctanoic acid (CAS 276869-41-1) is a chemical compound with the molecular formula C27H33NO6 and a molecular weight of 467.6 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-8-[(2-methylpropan-2-yl)oxy]-8-oxooctanoic acid. InChIKey: ULPCAXORIFXUMN-QHCPKHFHSA-N.
| Molecular formula | C27H33NO6 |
|---|---|
| Molecular weight | 467.6 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-8-[(2-methylpropan-2-yl)oxy]-8-oxooctanoic acid |
| InChIKey | ULPCAXORIFXUMN-QHCPKHFHSA-N |
| SMILES | CC(C)(C)OC(=O)CCCCC[C@@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)
Synonyms:
Fmoc-Asu(OtBu)-OH, (S)-Fmoc-2-Aminooctanedioic acid 8-tert-butyl ester, (2S)-8-tert-butoxy-2-(9H-fluoren-9-ylmethoxycarbonylamino)-8-oxo-octanoic acid, (2S)-8-(tert-butoxy)-2-({[(9H-fluoren-9-yl)meth, (S)-2-Fmoc-amino-8-(tert-butoxy)-8-oxooctanoic acid, (S)-2-(Fmoc-amino)-8-(tert-butoxy)-8-oxooctanoic Acid, (S)-Fmoc-2-Aminooctanedioic acid 8-tert-butyl ester/Fmoc-Asu(OtBu)-OH, (S)-2-(((9H-fluoren-9-yl)methoxy)carbonylamino)-8-tert-butoxy-8-oxooctanoic acid