CAS 276869-41-1 appears in our catalog under these names: Fmoc-asu(otbu)-oh, 97%, (S)–2–((((9H–Fluoren–9–yl)methoxy)carbonyl)amino)–8–(tert–butoxy)–8–oxooctanoic acid, Fmoc-L-Asu(tBu)-OH, Fmoc-Asu(OtBu)-OH 97%, (S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-8-(tert-butoxy)-8-oxooctanoic acid, 97%, 97%. Offered by: Combi-blocks, GLPBio, Iris Biotech, Ambeed, Chemat. Available pack sizes: 1g, 250mg, 100mg, 5g, 1 g, 500 mg, 5 g, 250 mg.
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-8-[(2-methylpropan-2-yl)oxy]-8-oxooctanoic acid (CAS 276869-41-1) is a chemical compound with the molecular formula C27H33NO6 and a molecular weight of 467.6 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-8-[(2-methylpropan-2-yl)oxy]-8-oxooctanoic acid. InChIKey: ULPCAXORIFXUMN-QHCPKHFHSA-N.
| Molecular formula | C27H33NO6 |
|---|---|
| Molecular weight | 467.6 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-8-[(2-methylpropan-2-yl)oxy]-8-oxooctanoic acid |
| InChIKey | ULPCAXORIFXUMN-QHCPKHFHSA-N |
| SMILES | CC(C)(C)OC(=O)CCCCC[C@@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)