cas: 1381787-76-3 — see every product listed under this CAS number, including other names
Fmoc-Bph2C-OH, 98% (CAS 1381787-76-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch12JJSC-100mg |
| cas | 1381787-76-3 |
| size | 100mg |
| availability | 15g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 198.80 Pln | |
| Chemat | 250mg | 314.00 Pln | |
| Chemat | 1g | 693.20 Pln | |
| Chemat | 5g | 2781.20 Pln | |
| Fluorochem | 250mg | 388.42 Pln | |
| Fluorochem | 1g | 883.04 Pln | |
| Fluorochem | 5g | 4090.24 Pln | |
| Fluorochem | 10g | 6943.41 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2S)-3-[4-(2-chlorophenyl)phenyl]-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (CAS 1381787-76-3) is a chemical compound with the molecular formula C30H24ClNO4 and a molecular weight of 498.0 g/mol. IUPAC name: (2S)-3-[4-(2-chlorophenyl)phenyl]-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid. InChIKey: WYGRUJUYUOLUCE-NDEPHWFRSA-N.
| Molecular formula | C30H24ClNO4 |
|---|---|
| Molecular weight | 498.0 g/mol |
| IUPAC name | (2S)-3-[4-(2-chlorophenyl)phenyl]-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| InChIKey | WYGRUJUYUOLUCE-NDEPHWFRSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CC4=CC=C(C=C4)C5=CC=CC=C5Cl)C(=O)O |
Computed by PubChem (NCBI)