CAS 1282042-60-7 appears in our catalog under these names: Fmoc-L-Bip(4-Cl)-OH, Fmoc-L-Bip(4’-Cl)-OH 98%. Offered by: Iris Biotech, Ambeed. Available pack sizes: on request, 100mg, 250mg, 1g.
(2S)-3-[4-(4-chlorophenyl)phenyl]-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (CAS 1282042-60-7) is a chemical compound with the molecular formula C30H24ClNO4 and a molecular weight of 498.0 g/mol. IUPAC name: (2S)-3-[4-(4-chlorophenyl)phenyl]-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid. InChIKey: YJQNMNJDBMSIFY-NDEPHWFRSA-N.
| Molecular formula | C30H24ClNO4 |
|---|---|
| Molecular weight | 498.0 g/mol |
| IUPAC name | (2S)-3-[4-(4-chlorophenyl)phenyl]-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| InChIKey | YJQNMNJDBMSIFY-NDEPHWFRSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CC4=CC=C(C=C4)C5=CC=C(C=C5)Cl)C(=O)O |
Computed by PubChem (NCBI)