cas: 135673-97-1 — see every product listed under this CAS number, including other names
Fmoc-Cha-OH, 99% (CAS 135673-97-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 500g, 1kg. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A751063-250mg |
| cas | 135673-97-1 |
| size | 250mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 125.62 Pln | |
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 5g | 147.88 Pln | |
| Ambeed | 10g | 225.75 Pln | |
| Ambeed | 25g | 264.69 Pln | |
| Ambeed | 100g | 665.19 Pln | |
| Ambeed | 500g | 3029.25 Pln | |
| Ambeed | 1kg | 5104.06 Pln |
| purity | 99% |
|---|---|
| delivery time | 1-2 weeks |
(2S)-3-cyclohexyl-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (CAS 135673-97-1) is a chemical compound with the molecular formula C24H27NO4 and a molecular weight of 393.5 g/mol. IUPAC name: (2S)-3-cyclohexyl-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid. InChIKey: HIJAUEZBPWTKIV-QFIPXVFZSA-N.
| Molecular formula | C24H27NO4 |
|---|---|
| Molecular weight | 393.5 g/mol |
| IUPAC name | (2S)-3-cyclohexyl-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| InChIKey | HIJAUEZBPWTKIV-QFIPXVFZSA-N |
| SMILES | C1CCC(CC1)C[C@@H](C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)