CAS 53298-33-2 appears in our catalog under these names: Fmoc–Cys(Bzl)–OH, Fmoc-L-Cys(Bzl)-OH, (R)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-(benzylthio)propanoic acid, 98%, 98%, Fmoc-Cys(Bzl)-OH, 98%. Offered by: GLPBio, Iris Biotech, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 100g, 1g, 10g.
(2R)-3-benzylsulfanyl-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (CAS 53298-33-2) is a chemical compound with the molecular formula C25H23NO4S and a molecular weight of 433.5 g/mol. IUPAC name: (2R)-3-benzylsulfanyl-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid. InChIKey: AKXYVGAAQGLAMD-QHCPKHFHSA-N.
| Molecular formula | C25H23NO4S |
|---|---|
| Molecular weight | 433.5 g/mol |
| IUPAC name | (2R)-3-benzylsulfanyl-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| InChIKey | AKXYVGAAQGLAMD-QHCPKHFHSA-N |
| SMILES | C1=CC=C(C=C1)CSC[C@@H](C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)