CAS 1244724-97-7 appears in our catalog under these names: (R)-N-Fmoc-3-amino-4-(phenylthio)butanoic acid, 90%, Fmoc-D-β-HoCys(Ph)-OH 90%, (R)-N-Fmoc-3-amino-4-(phenylthio)butanoic Acid, 90%, 90%, (R)-3-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-4-(phenylthio)butanoic acid, 97%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg.
(3R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-phenylsulfanylbutanoic acid (CAS 1244724-97-7) is a chemical compound with the molecular formula C25H23NO4S and a molecular weight of 433.5 g/mol. IUPAC name: (3R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-phenylsulfanylbutanoic acid. InChIKey: ZXVKPJJQNJPHQT-QGZVFWFLSA-N.
| Molecular formula | C25H23NO4S |
|---|---|
| Molecular weight | 433.5 g/mol |
| IUPAC name | (3R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-phenylsulfanylbutanoic acid |
| InChIKey | ZXVKPJJQNJPHQT-QGZVFWFLSA-N |
| SMILES | C1=CC=C(C=C1)SC[C@@H](CC(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)