cas: 73724-43-3 — see every product listed under this CAS number, including other names
Fmoc-Cys(StBu)-OH 95% (CAS 73724-43-3) is a chemical reagent available from Chemat. Available pack sizes: 500g, 100mg, 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A864079-500g |
| cas | 73724-43-3 |
| size | 500g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 500g | 25212.50 Pln | |
| Ambeed | 100mg | 147.88 Pln | |
| Ambeed | 250mg | 164.56 Pln | |
| Ambeed | 1g | 186.81 Pln | |
| Ambeed | 5g | 542.81 Pln | |
| Ambeed | 10g | 909.94 Pln | |
| Ambeed | 25g | 1955.69 Pln | |
| Ambeed | 100g | 6355.62 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A864079 |
(2R)-3-(tert-butyldisulfanyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (CAS 73724-43-3) is a chemical compound with the molecular formula C22H25NO4S2 and a molecular weight of 431.6 g/mol. IUPAC name: (2R)-3-(tert-butyldisulfanyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid. InChIKey: ZDUMTHLUTJOUML-IBGZPJMESA-N.
| Molecular formula | C22H25NO4S2 |
|---|---|
| Molecular weight | 431.6 g/mol |
| IUPAC name | (2R)-3-(tert-butyldisulfanyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| InChIKey | ZDUMTHLUTJOUML-IBGZPJMESA-N |
| SMILES | CC(C)(C)SSC[C@@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)