cas: 187618-60-6 — see every product listed under this CAS number, including other names
Fmoc-D-Arg(Pbf)-OH 97% (CAS 187618-60-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 500g, 1000g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A109500-250mg |
| cas | 187618-60-6 |
| size | 250mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 120.06 Pln | |
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 5g | 175.69 Pln | |
| Ambeed | 10g | 203.50 Pln | |
| Ambeed | 25g | 387.06 Pln | |
| Ambeed | 100g | 1099.06 Pln | |
| Ambeed | 500g | 3652.25 Pln | |
| Ambeed | 1000g | 6160.94 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A109500 |
(2R)-5-[[amino-[(2,2,4,6,7-pentamethyl-3H-1-benzofuran-5-yl)sulfonylamino]methylidene]amino]-2-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoic acid (CAS 187618-60-6) is a chemical compound with the molecular formula C34H40N4O7S and a molecular weight of 648.8 g/mol. IUPAC name: (2R)-5-[[amino-[(2,2,4,6,7-pentamethyl-3H-1-benzofuran-5-yl)sulfonylamino]methylidene]amino]-2-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoic acid. InChIKey: HNICLNKVURBTKV-MUUNZHRXSA-N.
| Molecular formula | C34H40N4O7S |
|---|---|
| Molecular weight | 648.8 g/mol |
| IUPAC name | (2R)-5-[[amino-[(2,2,4,6,7-pentamethyl-3H-1-benzofuran-5-yl)sulfonylamino]methylidene]amino]-2-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoic acid |
| InChIKey | HNICLNKVURBTKV-MUUNZHRXSA-N |
| SMILES | CC1=C(C(=C(C2=C1OC(C2)(C)C)C)S(=O)(=O)NC(=NCCC[C@H](C(=O)O)NC(=O)OCC3C4=CC=CC=C4C5=CC=CC=C35)N)C |
Computed by PubChem (NCBI)