cas: 187618-60-6 — see every product listed under this CAS number, including other names
Fmoc-D-Arg(Pbf)-OH, 99%, 99% (CAS 187618-60-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 500g, 1kg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I2VL-250mg |
| cas | 187618-60-6 |
| size | 250mg |
| availability | 10000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 74.00 Pln | |
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 98.00 Pln | |
| Chemat | 10g | 131.60 Pln | |
| Chemat | 25g | 232.40 Pln | |
| Chemat | 100g | 717.20 Pln | |
| Chemat | 500g | 3163.20 Pln | |
| Chemat | 1kg | 3909.20 Pln | |
| Chemat | 50g | 395.60 Pln | |
| Chemat | 250g | 1648.40 Pln |
| purity | 99% |
|---|---|
| delivery time | 3 weeks |
(2R)-5-[[amino-[(2,2,4,6,7-pentamethyl-3H-1-benzofuran-5-yl)sulfonylamino]methylidene]amino]-2-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoic acid (CAS 187618-60-6) is a chemical compound with the molecular formula C34H40N4O7S and a molecular weight of 648.8 g/mol. IUPAC name: (2R)-5-[[amino-[(2,2,4,6,7-pentamethyl-3H-1-benzofuran-5-yl)sulfonylamino]methylidene]amino]-2-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoic acid. InChIKey: HNICLNKVURBTKV-MUUNZHRXSA-N.
| Molecular formula | C34H40N4O7S |
|---|---|
| Molecular weight | 648.8 g/mol |
| IUPAC name | (2R)-5-[[amino-[(2,2,4,6,7-pentamethyl-3H-1-benzofuran-5-yl)sulfonylamino]methylidene]amino]-2-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoic acid |
| InChIKey | HNICLNKVURBTKV-MUUNZHRXSA-N |
| SMILES | CC1=C(C(=C(C2=C1OC(C2)(C)C)C)S(=O)(=O)NC(=NCCC[C@H](C(=O)O)NC(=O)OCC3C4=CC=CC=C4C5=CC=CC=C35)N)C |
Computed by PubChem (NCBI)