cas: 130752-32-8 — see every product listed under this CAS number, including other names
Fmoc-D-Arg-OH 95% (CAS 130752-32-8) is a chemical reagent available from Chemat. Available pack sizes: 500g, 250mg, 1g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A121413-500g |
| cas | 130752-32-8 |
| size | 500g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 500g | 2984.75 Pln | |
| Ambeed | 250mg | 120.06 Pln | |
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 10g | 181.25 Pln | |
| Ambeed | 25g | 275.81 Pln | |
| Ambeed | 100g | 670.75 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A121413 |
(2R)-5-(diaminomethylideneamino)-2-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoic acid (CAS 130752-32-8) is a chemical compound with the molecular formula C21H24N4O4 and a molecular weight of 396.4 g/mol. IUPAC name: (2R)-5-(diaminomethylideneamino)-2-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoic acid. InChIKey: DVBUCBXGDWWXNY-GOSISDBHSA-N.
| Molecular formula | C21H24N4O4 |
|---|---|
| Molecular weight | 396.4 g/mol |
| IUPAC name | (2R)-5-(diaminomethylideneamino)-2-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoic acid |
| InChIKey | DVBUCBXGDWWXNY-GOSISDBHSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@H](CCCN=C(N)N)C(=O)O |
Computed by PubChem (NCBI)