cas: 178119-93-2 — see every product listed under this CAS number, including other names
Fmoc-D-Phg(4-OH)-OH 95% (CAS 178119-93-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A765141-1g |
| cas | 178119-93-2 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 175.69 Pln | |
| Ambeed | 5g | 437.12 Pln | |
| Ambeed | 25g | 1327.12 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A765141 |
(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-(4-hydroxyphenyl)acetic acid (CAS 178119-93-2) is a chemical compound with the molecular formula C23H19NO5 and a molecular weight of 389.4 g/mol. IUPAC name: (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-(4-hydroxyphenyl)acetic acid. InChIKey: QBYSEGZHOGZXFO-OAQYLSRUSA-N.
| Molecular formula | C23H19NO5 |
|---|---|
| Molecular weight | 389.4 g/mol |
| IUPAC name | (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-(4-hydroxyphenyl)acetic acid |
| InChIKey | QBYSEGZHOGZXFO-OAQYLSRUSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@H](C4=CC=C(C=C4)O)C(=O)O |
Computed by PubChem (NCBI)