cas: 178119-93-2 — see every product listed under this CAS number, including other names
(R)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-2-(4-hydroxyphenyl)acetic acid, 95%, 95% (CAS 178119-93-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1136RM-1g |
| cas | 178119-93-2 |
| size | 1g |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 150.80 Pln | |
| Chemat | 5g | 458.00 Pln | |
| Chemat | 25g | 1077.20 Pln | |
| Chemat | 250mg | 117.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-(4-hydroxyphenyl)acetic acid (CAS 178119-93-2) is a chemical compound with the molecular formula C23H19NO5 and a molecular weight of 389.4 g/mol. IUPAC name: (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-(4-hydroxyphenyl)acetic acid. InChIKey: QBYSEGZHOGZXFO-OAQYLSRUSA-N.
| Molecular formula | C23H19NO5 |
|---|---|
| Molecular weight | 389.4 g/mol |
| IUPAC name | (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-(4-hydroxyphenyl)acetic acid |
| InChIKey | QBYSEGZHOGZXFO-OAQYLSRUSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@H](C4=CC=C(C=C4)O)C(=O)O |
Computed by PubChem (NCBI)