cas: 130309-33-0 — see every product listed under this CAS number, including other names
Fmoc-D-Tic-OH, 97%, 97% (CAS 130309-33-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111U0A-250mg |
| cas | 130309-33-0 |
| size | 250mg |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 83.60 Pln | |
| Chemat | 5g | 117.20 Pln | |
| Chemat | 10g | 150.80 Pln | |
| Chemat | 25g | 194.00 Pln | |
| Chemat | 50g | 328.40 Pln | |
| Chemat | 100g | 592.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(3R)-2-(9H-fluoren-9-ylmethoxycarbonyl)-3,4-dihydro-1H-isoquinoline-3-carboxylic acid (CAS 130309-33-0) is a chemical compound with the molecular formula C25H21NO4 and a molecular weight of 399.4 g/mol. IUPAC name: (3R)-2-(9H-fluoren-9-ylmethoxycarbonyl)-3,4-dihydro-1H-isoquinoline-3-carboxylic acid. InChIKey: LIRBCUNCXDZOOU-HSZRJFAPSA-N.
| Molecular formula | C25H21NO4 |
|---|---|
| Molecular weight | 399.4 g/mol |
| IUPAC name | (3R)-2-(9H-fluoren-9-ylmethoxycarbonyl)-3,4-dihydro-1H-isoquinoline-3-carboxylic acid |
| InChIKey | LIRBCUNCXDZOOU-HSZRJFAPSA-N |
| SMILES | C1[C@@H](N(CC2=CC=CC=C21)C(=O)OCC3C4=CC=CC=C4C5=CC=CC=C35)C(=O)O |
Computed by PubChem (NCBI)