cas: 478183-59-4 — see every product listed under this CAS number, including other names
Fmoc-D-Tyr(3-Cl)-OH 95% (CAS 478183-59-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A143847-1g |
| cas | 478183-59-4 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 487.19 Pln | |
| Ambeed | 5g | 1788.81 Pln | |
| Ambeed | 10g | 3118.25 Pln | |
| Ambeed | 25g | 6066.38 Pln | |
| Ambeed | 100g | 19260.62 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A143847 |
(2R)-3-(3-chloro-4-hydroxyphenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (CAS 478183-59-4) is a chemical compound with the molecular formula C24H20ClNO5 and a molecular weight of 437.9 g/mol. IUPAC name: (2R)-3-(3-chloro-4-hydroxyphenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid. InChIKey: KHDGYTHHDSEGNQ-OAQYLSRUSA-N.
| Molecular formula | C24H20ClNO5 |
|---|---|
| Molecular weight | 437.9 g/mol |
| IUPAC name | (2R)-3-(3-chloro-4-hydroxyphenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| InChIKey | KHDGYTHHDSEGNQ-OAQYLSRUSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@H](CC4=CC(=C(C=C4)O)Cl)C(=O)O |
Computed by PubChem (NCBI)