CAS 478183-59-4 appears in our catalog under these names: Fmoc-D-3-chlorotyrosine, 97%, Fmoc-D-Tyr(3-Cl)-OH, 95%, 95%, Fmoc-D-Tyr(3-Cl)-OH, 95%. Offered by: Combi-blocks, Chemat, Ambeed. Available pack sizes: 1g, 10g, 5g, 25g, 100g.
(2R)-3-(3-chloro-4-hydroxyphenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (CAS 478183-59-4) is a chemical compound with the molecular formula C24H20ClNO5 and a molecular weight of 437.9 g/mol. IUPAC name: (2R)-3-(3-chloro-4-hydroxyphenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid. InChIKey: KHDGYTHHDSEGNQ-OAQYLSRUSA-N.
| Molecular formula | C24H20ClNO5 |
|---|---|
| Molecular weight | 437.9 g/mol |
| IUPAC name | (2R)-3-(3-chloro-4-hydroxyphenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| InChIKey | KHDGYTHHDSEGNQ-OAQYLSRUSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@H](CC4=CC(=C(C=C4)O)Cl)C(=O)O |
Computed by PubChem (NCBI)