cas: 118488-18-9 — see every product listed under this CAS number, including other names
Fmoc-D-Tyr(tBu)-OH, 96% (CAS 118488-18-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 500g, 1kg. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A239263-250mg |
| cas | 118488-18-9 |
| size | 250mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 125.62 Pln | |
| Ambeed | 1g | 136.75 Pln | |
| Ambeed | 5g | 164.56 Pln | |
| Ambeed | 10g | 209.06 Pln | |
| Ambeed | 25g | 342.56 Pln | |
| Ambeed | 100g | 1165.81 Pln | |
| Ambeed | 500g | 5543.50 Pln | |
| Ambeed | 1kg | 8825.38 Pln |
| purity | 96% |
|---|---|
| delivery time | 1-2 weeks |
(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[4-[(2-methylpropan-2-yl)oxy]phenyl]propanoic acid (CAS 118488-18-9) is a chemical compound with the molecular formula C28H29NO5 and a molecular weight of 459.5 g/mol. IUPAC name: (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[4-[(2-methylpropan-2-yl)oxy]phenyl]propanoic acid. InChIKey: JAUKCFULLJFBFN-RUZDIDTESA-N.
| Molecular formula | C28H29NO5 |
|---|---|
| Molecular weight | 459.5 g/mol |
| IUPAC name | (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[4-[(2-methylpropan-2-yl)oxy]phenyl]propanoic acid |
| InChIKey | JAUKCFULLJFBFN-RUZDIDTESA-N |
| SMILES | CC(C)(C)OC1=CC=C(C=C1)C[C@H](C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)