CAS 133852-23-0 appears in our catalog under these names: Fmoc–Tyr–OtBu, Fmoc-Tyr-OtBu 98%, N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-L-tyrosine 1,1-dimethylethyl ester, 98%, 98%, Fmoc-Tyr-OtBu, 97%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100g, 25g, 1g, 5g, 10g, 500g.
Tert-butyl (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(4-hydroxyphenyl)propanoate (CAS 133852-23-0) is a chemical compound with the molecular formula C28H29NO5 and a molecular weight of 459.5 g/mol. IUPAC name: tert-butyl (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(4-hydroxyphenyl)propanoate. InChIKey: VJSGNJOUWWMJDE-VWLOTQADSA-N.
| Molecular formula | C28H29NO5 |
|---|---|
| Molecular weight | 459.5 g/mol |
| IUPAC name | tert-butyl (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(4-hydroxyphenyl)propanoate |
| InChIKey | VJSGNJOUWWMJDE-VWLOTQADSA-N |
| SMILES | CC(C)(C)OC(=O)[C@H](CC1=CC=C(C=C1)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)