Fmoc-D-methionine sulfone, 98%, 98%
cas: 1247791-23-6 — see every product listed under this CAS number, including other names
Fmoc-D-methionine sulfone, 98%, 98% (CAS 1247791-23-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch110DNL-100mg |
| cas | 1247791-23-6 |
| size | 100mg |
| availability | 15g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 150.80 Pln | |
| Chemat | 250mg | 213.20 Pln | |
| Chemat | 1g | 467.60 Pln | |
| Chemat | 5g | 1480.40 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-methylsulfonylbutanoic acid (CAS 1247791-23-6) is a chemical compound with the molecular formula C20H21NO6S and a molecular weight of 403.5 g/mol. IUPAC name: (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-methylsulfonylbutanoic acid. InChIKey: KJLKPACOHZKRFM-GOSISDBHSA-N.
| Molecular formula | C20H21NO6S |
|---|---|
| Molecular weight | 403.5 g/mol |
| IUPAC name | (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-methylsulfonylbutanoic acid |
| InChIKey | KJLKPACOHZKRFM-GOSISDBHSA-N |
| SMILES | CS(=O)(=O)CC[C@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)
Synonyms:
Fmoc-D-methionine sulfone, Fmoc-D-Met(O2)-OH, (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-methylsulfonylbutanoic acid, (R)-2-(Fmoc-amino)-4-(methylsulfonyl)butanoic Acid, Fmoc-D-Met(O)2-OH, (9H-Fluoren-9-yl)MethOxy]Carbonyl D-Met(O)2-OH, (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-methylsulfonyl-butanoic acid, (R)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-4-(methylsulfonyl)butanoicacid, N-alpha-(9-Fluorenylmethyloxycarbonyl)-D-methioninesulfon (Fmoc-D-Met(O2)-OH)