CAS 1247791-23-6 appears in our catalog under these names: Fmoc-d-met(o2)-oh, 96%, Fmoc-D-Met(O2)-OH, Fmoc-D-Met(O2)-OH 96%, Fmoc-D-methionine sulfone, 98%, 98%, (R)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-4-(methylsulfonyl)butanoic acid, 98%. Offered by: Combi-blocks, Iris Biotech, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 10g, 25g, 5g, 250mg, 100mg.
(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-methylsulfonylbutanoic acid (CAS 1247791-23-6) is a chemical compound with the molecular formula C20H21NO6S and a molecular weight of 403.5 g/mol. IUPAC name: (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-methylsulfonylbutanoic acid. InChIKey: KJLKPACOHZKRFM-GOSISDBHSA-N.
| Molecular formula | C20H21NO6S |
|---|---|
| Molecular weight | 403.5 g/mol |
| IUPAC name | (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-methylsulfonylbutanoic acid |
| InChIKey | KJLKPACOHZKRFM-GOSISDBHSA-N |
| SMILES | CS(=O)(=O)CC[C@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)