CAS 678988-18-6 appears in our catalog under these names: 2-(((9H-Fluoren-9-yl)methoxy)carbonylamino)-2-(4-fluorophenyl)acetic acid, 2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-2-(4-fluorophenyl)acetic acid, 97%, 97%. Offered by: Biosynth, Chemat. Available pack sizes: 250mg, 2,5g, 100mg, 1g, 5g.
2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-(4-fluorophenyl)acetic acid (CAS 678988-18-6) is a chemical compound with the molecular formula C23H18FNO4 and a molecular weight of 391.4 g/mol. IUPAC name: 2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-(4-fluorophenyl)acetic acid. InChIKey: UUEGPRZUDVECNF-UHFFFAOYSA-N.
| Molecular formula | C23H18FNO4 |
|---|---|
| Molecular weight | 391.4 g/mol |
| IUPAC name | 2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-(4-fluorophenyl)acetic acid |
| InChIKey | UUEGPRZUDVECNF-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NC(C4=CC=C(C=C4)F)C(=O)O |
Computed by PubChem (NCBI)