Products 1260605-81-9
CAS 1260605-81-9 appears in our catalog under these names: (S)-2-N-Fmoc-2-(2-fluorophenyl)acetic acid, 99%, (S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-2-(2-fluorophenyl)acetic acid, 99%. Offered by: Ambeed, BLDpharm. Available pack sizes: 250mg, 1g, 100mg.
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-(2-fluorophenyl)acetic acid (CAS 1260605-81-9) is a chemical compound with the molecular formula C23H18FNO4 and a molecular weight of 391.4 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-(2-fluorophenyl)acetic acid. InChIKey: HFDAWMNMWMAJCX-NRFANRHFSA-N.
| Molecular formula | C23H18FNO4 |
|---|---|
| Molecular weight | 391.4 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-(2-fluorophenyl)acetic acid |
| InChIKey | HFDAWMNMWMAJCX-NRFANRHFSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](C4=CC=CC=C4F)C(=O)O |
Computed by PubChem (NCBI)