cas: 125238-99-5 — see every product listed under this CAS number, including other names
Fmoc-Dab(Boc)-OH 97% (CAS 125238-99-5) is a chemical reagent available from Chemat. Available pack sizes: 1000g, 250mg, 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A239334-1000g |
| cas | 125238-99-5 |
| size | 1000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1000g | 6767.25 Pln | |
| Ambeed | 250mg | 120.06 Pln | |
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 5g | 203.50 Pln | |
| Ambeed | 10g | 220.19 Pln | |
| Ambeed | 25g | 292.50 Pln | |
| Ambeed | 100g | 915.50 Pln | |
| Ambeed | 500g | 4253.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A239334 |
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid (CAS 125238-99-5) is a chemical compound with the molecular formula C24H28N2O6 and a molecular weight of 440.5 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid. InChIKey: LIWKOFAHRLBNMG-FQEVSTJZSA-N.
| Molecular formula | C24H28N2O6 |
|---|---|
| Molecular weight | 440.5 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
| InChIKey | LIWKOFAHRLBNMG-FQEVSTJZSA-N |
| SMILES | CC(C)(C)OC(=O)NCC[C@@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)