CAS 141743-15-9 appears in our catalog under these names: Fmoc–N–(N–β–Boc–aminoethyl)–Gly–OH, Fmoc-Aeg(Boc)-OH, Fmoc-N-(2-Boc-aminoethyl)-Gly-OH , 99.00%, Fmoc-N-(2-Boc-aminoethyl)-Gly-OH 95%, Fmoc-N-(2-Boc-aminoethyl)-Gly-OH, 99.76%. Offered by: GLPBio, Iris Biotech, Chemat, Ambeed, MedChemExpress. Available pack sizes: 1g, 5g, 25g, 500mg, 100mg, 250mg, 100 mg, 250 mg.
2-[9H-fluoren-9-ylmethoxycarbonyl-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]amino]acetic acid (CAS 141743-15-9) is a chemical compound with the molecular formula C24H28N2O6 and a molecular weight of 440.5 g/mol. IUPAC name: 2-[9H-fluoren-9-ylmethoxycarbonyl-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]amino]acetic acid. InChIKey: SMLJSDLXJRGOKW-UHFFFAOYSA-N.
| Molecular formula | C24H28N2O6 |
|---|---|
| Molecular weight | 440.5 g/mol |
| IUPAC name | 2-[9H-fluoren-9-ylmethoxycarbonyl-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]amino]acetic acid |
| InChIKey | SMLJSDLXJRGOKW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCCN(CC(=O)O)C(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)